C27H20F3N5O2 — CID 59397100
1-[4-methyl-3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-(2,3,6-trifluorophenyl)urea (PubChem CID 59397100) has the molecular formula C27H20F3N5O2 and a molecular weight of 503.48 g/mol. Its IUPAC name is 1-[4-methyl-3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-(2,3,6-trifluorophenyl)urea.
| Compound Name | 1-[4-methyl-3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-(2,3,6-trifluorophenyl)urea |
|---|---|
| PubChem CID | 59397100 |
| Molecular Formula | C27H20F3N5O2 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 1-[4-methyl-3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-(2,3,6-trifluorophenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2c(F)ccc(F)c2F)cc1Nc1ccc2c(c1)NC(=O)/C2=C\c1ccc[nH]1 |
| InChI | InChI=1S/C27H20F3N5O2/c1-14-4-5-17(33-27(37)35-25-21(29)9-8-20(28)24(25)30)12-22(14)32-16-6-7-18-19(11-15-3-2-10-31-15)26(36)34-23(18)13-16/h2-13,31-32H,1H3,(H,34,36)(H2,33,35,37)/b19-11- |
| InChIKey | MGPKSQMGCISJGC-ODLFYWEKSA-N |
| XLogP | 6.62 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|