C17H15F3N2O — CID 59397218
(1S,14R,15S)-13-(trifluoromethyl)-5,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-ol (PubChem CID 59397218) has the molecular formula C17H15F3N2O and a molecular weight of 320.31 g/mol. Its IUPAC name is (1S,14R,15S)-13-(trifluoromethyl)-5,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-ol.
| Compound Name | (1S,14R,15S)-13-(trifluoromethyl)-5,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-ol |
|---|---|
| PubChem CID | 59397218 |
| Molecular Formula | C17H15F3N2O |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (1S,14R,15S)-13-(trifluoromethyl)-5,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-ol |
| SMILES | O[C@H]1C(C(F)(F)F)=C2c3ccc4[nH]cnc4c3C[C@@]23CC[C@H]1C3 |
| InChI | InChI=1S/C17H15F3N2O/c18-17(19,20)13-12-9-1-2-11-14(22-7-21-11)10(9)6-16(12)4-3-8(5-16)15(13)23/h1-2,7-8,15,23H,3-6H2,(H,21,22)/t8-,15+,16-/m0/s1 |
| InChIKey | DFCOMLYZUDKONM-KHQRDOKYSA-N |
| XLogP | 3.60 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |