C34H5F18O5S- — CID 59397594
4,6-bis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]naphthalene-2-sulfonate (PubChem CID 59397594) has the molecular formula C34H5F18O5S- and a molecular weight of 867.44 g/mol. Its IUPAC name is 4,6-bis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]naphthalene-2-sulfonate.
| Compound Name | 4,6-bis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 59397594 |
| Molecular Formula | C34H5F18O5S- |
| Molecular Weight | 867.44 g/mol |
| Exact Mass | 866.96 |
| IUPAC Name | 4,6-bis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1cc(Oc2c(F)c(F)c(-c3c(F)c(F)c(F)c(F)c3F)c(F)c2F)c2cc(Oc3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)ccc2c1 |
| InChI | InChI=1S/C34H6F18O5S/c35-15-11(16(36)24(44)27(47)23(15)43)13-19(39)29(49)33(30(50)20(13)40)56-7-2-1-6-3-8(58(53,54)55)5-10(9(6)4-7)57-34-31(51)21(41)14(22(42)32(34)52)12-17(37)25(45)28(48)26(46)18(12)38/h1-5H,(H,53,54,55)/p-1 |
| InChIKey | JKSBTEOBIJGMDD-UHFFFAOYSA-M |
| XLogP | 11.17 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.44 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|