C30H28N6O — CID 59397766
1-(2,6-dimethylpiperidin-1-yl)-2-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)indol-1-yl]ethanone (PubChem CID 59397766) has the molecular formula C30H28N6O and a molecular weight of 488.60 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)-2-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)indol-1-yl]ethanone.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)-2-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)indol-1-yl]ethanone |
|---|---|
| PubChem CID | 59397766 |
| Molecular Formula | C30H28N6O |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)-2-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)indol-1-yl]ethanone |
| SMILES | CC1CCCC(C)N1C(=O)Cn1cc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c2ccccc21 |
| InChI | InChI=1S/C30H28N6O/c1-18-8-5-9-19(2)36(18)25(37)17-35-16-23(20-10-3-4-13-24(20)35)30-33-28-21-11-6-14-31-26(21)27-22(29(28)34-30)12-7-15-32-27/h3-4,6-7,10-16,18-19H,5,8-9,17H2,1-2H3,(H,33,34) |
| InChIKey | CRRHDSLKKINSIB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|