C30H36N4O7 — CID 59398086
tert-butyl N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-[1-[2-(5-nitro-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamate (PubChem CID 59398086) has the molecular formula C30H36N4O7 and a molecular weight of 564.64 g/mol. Its IUPAC name is tert-butyl N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-[1-[2-(5-nitro-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-[1-[2-(5-nitro-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 59398086 |
| Molecular Formula | C30H36N4O7 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | tert-butyl N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-[1-[2-(5-nitro-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc2c(c1)OCCO2)C1CCN(CCn2c(=O)ccc3c([N+](=O)[O-])cccc32)CC1 |
| InChI | InChI=1S/C30H36N4O7/c1-30(2,3)41-29(36)33(20-21-7-9-26-27(19-21)40-18-17-39-26)22-11-13-31(14-12-22)15-16-32-24-5-4-6-25(34(37)38)23(24)8-10-28(32)35/h4-10,19,22H,11-18,20H2,1-3H3 |
| InChIKey | KZXBWIJEBAMOAR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 116.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|