C34H32O5 — CID 59398601
diethyl 5-(hydroxymethyl)-4,6,7-triphenyl-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 59398601) has the molecular formula C34H32O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is diethyl 5-(hydroxymethyl)-4,6,7-triphenyl-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 5-(hydroxymethyl)-4,6,7-triphenyl-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 59398601 |
| Molecular Formula | C34H32O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | diethyl 5-(hydroxymethyl)-4,6,7-triphenyl-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2c(c(-c3ccccc3)c(-c3ccccc3)c(CO)c2-c2ccccc2)C1 |
| InChI | InChI=1S/C34H32O5/c1-3-38-32(36)34(33(37)39-4-2)20-26-27(21-34)30(24-16-10-6-11-17-24)31(25-18-12-7-13-19-25)28(22-35)29(26)23-14-8-5-9-15-23/h5-19,35H,3-4,20-22H2,1-2H3 |
| InChIKey | YNFAYCCPGZLHDU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|