C23H29NSi2 — CID 59398634
N-benzyl-5-trimethylsilyl-N-(5-trimethylsilylpenta-2,4-diynyl)penta-2,4-diyn-1-amine (PubChem CID 59398634) has the molecular formula C23H29NSi2 and a molecular weight of 375.66 g/mol. Its IUPAC name is N-benzyl-5-trimethylsilyl-N-(5-trimethylsilylpenta-2,4-diynyl)penta-2,4-diyn-1-amine.
| Compound Name | N-benzyl-5-trimethylsilyl-N-(5-trimethylsilylpenta-2,4-diynyl)penta-2,4-diyn-1-amine |
|---|---|
| PubChem CID | 59398634 |
| Molecular Formula | C23H29NSi2 |
| Molecular Weight | 375.66 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-benzyl-5-trimethylsilyl-N-(5-trimethylsilylpenta-2,4-diynyl)penta-2,4-diyn-1-amine |
| SMILES | C[Si](C)(C)C#CC#CCN(CC#CC#C[Si](C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C23H29NSi2/c1-25(2,3)20-14-8-12-18-24(22-23-16-10-7-11-17-23)19-13-9-15-21-26(4,5)6/h7,10-11,16-17H,18-19,22H2,1-6H3 |
| InChIKey | MHWGQYNFWMMFNU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|