About CID 59399068
CID 59399068 (PubChem CID 59399068) has the molecular formula C27H24N3Pt-
and a molecular weight of 585.59 g/mol.
Molecular Properties
| Compound Name | CID 59399068 |
| PubChem CID | 59399068 |
| Molecular Formula | C27H24N3Pt- |
| Molecular Weight | 585.59 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | — |
| SMILES | CC1(C)c2[c-]c(ccc2)-c2cccc(n2)C(C)(C)c2cccc(n2)-c2cccc1n2.[Pt] |
| InChI | InChI=1S/C27H24N3.Pt/c1-26(2)19-10-5-9-18(17-19)20-11-6-15-24(28-20)27(3,4)25-16-8-13-22(30-25)21-12-7-14-23(26)29-21;/h5-16H,1-4H3;/q-1; |
| InChIKey | AXCOMDCOLMFLSS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59399068 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59399068?
The IUPAC name of CID 59399068 (CID 59399068) is not available.
What is the SMILES notation for CID 59399068?
The canonical SMILES for CID 59399068 is CC1(C)c2[c-]c(ccc2)-c2cccc(n2)C(C)(C)c2cccc(n2)-c2cccc1n2.[Pt].
What is the InChIKey of CID 59399068?
The InChIKey is AXCOMDCOLMFLSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N3.Pt/c1-26(2)19-10-5-9-18(17-19)20-11-6-15-24(28-20)27(3,4)25-16-8-13-22(30-25)21-12-7-14-23(26)29-21;/h5-16H,1-4H3;/q-1;.
What are the key properties of CID 59399068?
CID 59399068 has a molecular weight of 585.59 g/mol, XLogP of 5.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59399068 is sourced from PubChem (CID 59399068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).