About 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol
1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol (PubChem CID 59399081) has the molecular formula C24H25F2N3O
and a molecular weight of 409.48 g/mol. Its IUPAC name is 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol |
| PubChem CID | 59399081 |
| Molecular Formula | C24H25F2N3O |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol |
| SMILES | CC(C)(c1cccc(-c2ccc(F)nc2F)n1)c1cccc(C2(O)CCCCC2)n1 |
| InChI | InChI=1S/C24H25F2N3O/c1-23(2,19-10-7-11-20(28-19)24(30)14-4-3-5-15-24)18-9-6-8-17(27-18)16-12-13-21(25)29-22(16)26/h6-13,30H,3-5,14-15H2,1-2H3 |
| InChIKey | OCMHYKUHDNCHQP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol?
The IUPAC name of 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol (CID 59399081) is 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol?
The canonical SMILES for 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol is CC(C)(c1cccc(-c2ccc(F)nc2F)n1)c1cccc(C2(O)CCCCC2)n1.
What is the InChIKey of 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol?
The InChIKey is OCMHYKUHDNCHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F2N3O/c1-23(2,19-10-7-11-20(28-19)24(30)14-4-3-5-15-24)18-9-6-8-17(27-18)16-12-13-21(25)29-22(16)26/h6-13,30H,3-5,14-15H2,1-2H3.
What are the key properties of 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol?
1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol has a molecular weight of 409.48 g/mol, XLogP of 5.29, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol is sourced from PubChem (CID 59399081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).