C21H21F2N3O — CID 59399184
2-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol (PubChem CID 59399184) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 59399184 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1cccc(C(C)(C)c2cccc(-c3ccc(F)nc3F)n2)n1 |
| InChI | InChI=1S/C21H21F2N3O/c1-20(2,16-9-6-10-17(25-16)21(3,4)27)15-8-5-7-14(24-15)13-11-12-18(22)26-19(13)23/h5-12,27H,1-4H3 |
| InChIKey | YITAGSVIMBEIIY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|