C20H18F2N4O2 — CID 59399400
6-[tert-butyl-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]amino]pyridine-2-carboxylic acid (PubChem CID 59399400) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 6-[tert-butyl-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[tert-butyl-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59399400 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 6-[tert-butyl-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]amino]pyridine-2-carboxylic acid |
| SMILES | CC(C)(C)N(c1cccc(C(=O)O)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C20H18F2N4O2/c1-20(2,3)26(17-9-5-7-14(24-17)19(27)28)16-8-4-6-13(23-16)12-10-11-15(21)25-18(12)22/h4-11H,1-3H3,(H,27,28) |
| InChIKey | JJKVMHDYNYEJIM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|