C28H16N2O11S2-2 — CID 59400465
5-methyl-2-[4-(13-methyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-2-sulfonatophenoxy]benzenesulfonate (PubChem CID 59400465) has the molecular formula C28H16N2O11S2-2 and a molecular weight of 620.57 g/mol. Its IUPAC name is 5-methyl-2-[4-(13-methyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-2-sulfonatophenoxy]benzenesulfonate.
| Compound Name | 5-methyl-2-[4-(13-methyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-2-sulfonatophenoxy]benzenesulfonate |
|---|---|
| PubChem CID | 59400465 |
| Molecular Formula | C28H16N2O11S2-2 |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 620.02 |
| IUPAC Name | 5-methyl-2-[4-(13-methyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-2-sulfonatophenoxy]benzenesulfonate |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4ccc5c6c(ccc(c46)C3=O)C(=O)N(C)C5=O)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C28H18N2O11S2/c1-13-3-9-19(21(11-13)42(35,36)37)41-20-10-4-14(12-22(20)43(38,39)40)30-27(33)17-7-5-15-23-16(26(32)29(2)25(15)31)6-8-18(24(17)23)28(30)34/h3-12H,1-2H3,(H,35,36,37)(H,38,39,40)/p-2 |
| InChIKey | YOXYDTVAAFRWJY-UHFFFAOYSA-L |
| XLogP | 2.78 |
| TPSA | 198.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|