C24H25F12N2+ — CID 59400469
1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctyl)-4-(4-pyridin-4-ylhexan-2-yl)pyridin-1-ium (PubChem CID 59400469) has the molecular formula C24H25F12N2+ and a molecular weight of 569.45 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctyl)-4-(4-pyridin-4-ylhexan-2-yl)pyridin-1-ium.
| Compound Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctyl)-4-(4-pyridin-4-ylhexan-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 59400469 |
| Molecular Formula | C24H25F12N2+ |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctyl)-4-(4-pyridin-4-ylhexan-2-yl)pyridin-1-ium |
| SMILES | CCC(CC(C)c1cc[n+](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cc1)c1ccncc1 |
| InChI | InChI=1S/C24H25F12N2/c1-3-16(18-4-9-37-10-5-18)14-15(2)17-6-11-38(12-7-17)13-8-20(27,28)22(31,32)24(35,36)23(33,34)21(29,30)19(25)26/h4-7,9-12,15-16,19H,3,8,13-14H2,1-2H3/q+1 |
| InChIKey | OOIZKIQFFCGFFY-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|