About [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate
[9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate (PubChem CID 59400619) has the molecular formula C21H26O5
and a molecular weight of 358.43 g/mol. Its IUPAC name is [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate |
| PubChem CID | 59400619 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=C(c2cc(C)ccc2C)C(=O)CC2(CCOCC2)C1 |
| InChI | InChI=1S/C21H26O5/c1-4-25-20(23)26-18-13-21(7-9-24-10-8-21)12-17(22)19(18)16-11-14(2)5-6-15(16)3/h5-6,11H,4,7-10,12-13H2,1-3H3 |
| InChIKey | VCBXAWHSKDYUEL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate?
The IUPAC name of [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate (CID 59400619) is [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate.
What is the SMILES notation for [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate?
The canonical SMILES for [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate is CCOC(=O)OC1=C(c2cc(C)ccc2C)C(=O)CC2(CCOCC2)C1.
What is the InChIKey of [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate?
The InChIKey is VCBXAWHSKDYUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O5/c1-4-25-20(23)26-18-13-21(7-9-24-10-8-21)12-17(22)19(18)16-11-14(2)5-6-15(16)3/h5-6,11H,4,7-10,12-13H2,1-3H3.
What are the key properties of [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate?
[9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate has a molecular weight of 358.43 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(2,5-dimethylphenyl)-10-oxo-3-oxaspiro[5.5]undec-8-en-8-yl] ethyl carbonate is sourced from PubChem (CID 59400619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).