C22H27FO4Si — CID 59400967
[(2S,3R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-3-fluorooxolan-2-yl] acetate (PubChem CID 59400967) has the molecular formula C22H27FO4Si and a molecular weight of 402.54 g/mol. Its IUPAC name is [(2S,3R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-3-fluorooxolan-2-yl] acetate.
| Compound Name | [(2S,3R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-3-fluorooxolan-2-yl] acetate |
|---|---|
| PubChem CID | 59400967 |
| Molecular Formula | C22H27FO4Si |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(2S,3R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-3-fluorooxolan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H]1F |
| InChI | InChI=1S/C22H27FO4Si/c1-16(24)25-21-19(23)15-20(26-21)27-28(22(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-21H,15H2,1-4H3/t19-,20-,21-/m1/s1 |
| InChIKey | ZUTNNXJETTYTLX-NJDAHSKKSA-N |
| XLogP | 3.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|