About (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine
(NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine (PubChem CID 59401463) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine |
| PubChem CID | 59401463 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine |
| SMILES | CC(C)n1ncc2c1CCC/C2=N/O |
| InChI | InChI=1S/C10H15N3O/c1-7(2)13-10-5-3-4-9(12-14)8(10)6-11-13/h6-7,14H,3-5H2,1-2H3/b12-9- |
| InChIKey | FBRRRKAQFPGENX-XFXZXTDPSA-N |
| XLogP | 1.98 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine?
The IUPAC name of (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine (CID 59401463) is (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine.
What is the SMILES notation for (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine?
The canonical SMILES for (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine is CC(C)n1ncc2c1CCC/C2=N/O.
What is the InChIKey of (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine?
The InChIKey is FBRRRKAQFPGENX-XFXZXTDPSA-N. The full InChI is InChI=1S/C10H15N3O/c1-7(2)13-10-5-3-4-9(12-14)8(10)6-11-13/h6-7,14H,3-5H2,1-2H3/b12-9-.
What are the key properties of (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine?
(NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine has a molecular weight of 193.25 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(1-propan-2-yl-6,7-dihydro-5H-indazol-4-ylidene)hydroxylamine is sourced from PubChem (CID 59401463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).