C27H23ClN6O4 — CID 59402239
2-[4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetic acid (PubChem CID 59402239) has the molecular formula C27H23ClN6O4 and a molecular weight of 530.97 g/mol. Its IUPAC name is 2-[4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 59402239 |
| Molecular Formula | C27H23ClN6O4 |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 2-[4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)/C=C/c2cc(Cl)ccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C27H23ClN6O4/c28-21-9-12-24(34-17-29-32-33-34)20(16-21)8-13-25(35)31-23(14-18-4-2-1-3-5-18)27(38)30-22-10-6-19(7-11-22)15-26(36)37/h1-13,16-17,23H,14-15H2,(H,30,38)(H,31,35)(H,36,37)/b13-8+/t23-/m0/s1 |
| InChIKey | DRNNIJVASSWYII-NWMLYGLHSA-N |
| XLogP | 3.32 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|