C22H24O5 — CID 59402400
4-(ethoxymethyl)-1,2,3,7,9-pentamethyl-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde (PubChem CID 59402400) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 4-(ethoxymethyl)-1,2,3,7,9-pentamethyl-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde.
| Compound Name | 4-(ethoxymethyl)-1,2,3,7,9-pentamethyl-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde |
|---|---|
| PubChem CID | 59402400 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-(ethoxymethyl)-1,2,3,7,9-pentamethyl-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde |
| SMILES | CCOCc1c(C)c(C)c(C)c2c1OC(=O)c1c(C)cc(C)c(C=O)c1O2 |
| InChI | InChI=1S/C22H24O5/c1-7-25-10-17-14(5)13(4)15(6)19-21(17)27-22(24)18-12(3)8-11(2)16(9-23)20(18)26-19/h8-9H,7,10H2,1-6H3 |
| InChIKey | OMXOAXDEMFUMDL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|