About 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide
4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide (PubChem CID 59402559) has the molecular formula C13H20ClN3O2
and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide |
| PubChem CID | 59402559 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CCO[C@H]1CNCC[C@H]1NC(=O)c1cc(Cl)c(C)[nH]1 |
| InChI | InChI=1S/C13H20ClN3O2/c1-3-19-12-7-15-5-4-10(12)17-13(18)11-6-9(14)8(2)16-11/h6,10,12,15-16H,3-5,7H2,1-2H3,(H,17,18)/t10-,12+/m1/s1 |
| InChIKey | FANWLZVCOJHNJV-PWSUYJOCSA-N |
| XLogP | 1.47 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide (CID 59402559) is 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide is CCO[C@H]1CNCC[C@H]1NC(=O)c1cc(Cl)c(C)[nH]1.
What is the InChIKey of 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The InChIKey is FANWLZVCOJHNJV-PWSUYJOCSA-N. The full InChI is InChI=1S/C13H20ClN3O2/c1-3-19-12-7-15-5-4-10(12)17-13(18)11-6-9(14)8(2)16-11/h6,10,12,15-16H,3-5,7H2,1-2H3,(H,17,18)/t10-,12+/m1/s1.
What are the key properties of 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide has a molecular weight of 285.78 g/mol, XLogP of 1.47, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3S,4R)-3-ethoxypiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 59402559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).