C15H18F3NO6S — CID 59403460
tert-butyl 8-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (PubChem CID 59403460) has the molecular formula C15H18F3NO6S and a molecular weight of 397.37 g/mol. Its IUPAC name is tert-butyl 8-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate.
| Compound Name | tert-butyl 8-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
|---|---|
| PubChem CID | 59403460 |
| Molecular Formula | C15H18F3NO6S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | tert-butyl 8-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1 |
| InChI | InChI=1S/C15H18F3NO6S/c1-14(2,3)24-13(20)19-6-7-23-12-8-11(5-4-10(12)9-19)25-26(21,22)15(16,17)18/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | IFVFDFDWZISSQU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|