About tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate
tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (PubChem CID 59403522) has the molecular formula C15H18F3NO6S
and a molecular weight of 397.37 g/mol. Its IUPAC name is tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| PubChem CID | 59403522 |
| Molecular Formula | C15H18F3NO6S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOc2c(cccc2OS(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C15H18F3NO6S/c1-14(2,3)24-13(20)19-7-8-23-12-10(9-19)5-4-6-11(12)25-26(21,22)15(16,17)18/h4-6H,7-9H2,1-3H3 |
| InChIKey | MMFOYNVNAZGWQU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate?
The IUPAC name of tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (CID 59403522) is tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate.
What is the SMILES notation for tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate?
The canonical SMILES for tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate is CC(C)(C)OC(=O)N1CCOc2c(cccc2OS(=O)(=O)C(F)(F)F)C1.
What is the InChIKey of tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate?
The InChIKey is MMFOYNVNAZGWQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3NO6S/c1-14(2,3)24-13(20)19-7-8-23-12-10(9-19)5-4-6-11(12)25-26(21,22)15(16,17)18/h4-6H,7-9H2,1-3H3.
What are the key properties of tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate?
tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate has a molecular weight of 397.37 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 9-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate is sourced from PubChem (CID 59403522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).