About 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide
5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide (PubChem CID 59403811) has the molecular formula C18H14OS
and a molecular weight of 278.38 g/mol. Its IUPAC name is 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide.
Molecular Properties
| Compound Name | 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide |
| PubChem CID | 59403811 |
| Molecular Formula | C18H14OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide |
| SMILES | Cc1ccc2c(c1)S(=O)c1cc(C)c3ccccc3c1-2 |
| InChI | InChI=1S/C18H14OS/c1-11-7-8-15-16(9-11)20(19)17-10-12(2)13-5-3-4-6-14(13)18(15)17/h3-10H,1-2H3 |
| InChIKey | DCPCZGGITVEAFC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide?
The IUPAC name of 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide (CID 59403811) is 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide.
What is the SMILES notation for 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide?
The canonical SMILES for 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide is Cc1ccc2c(c1)S(=O)c1cc(C)c3ccccc3c1-2.
What is the InChIKey of 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide?
The InChIKey is DCPCZGGITVEAFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14OS/c1-11-7-8-15-16(9-11)20(19)17-10-12(2)13-5-3-4-6-14(13)18(15)17/h3-10H,1-2H3.
What are the key properties of 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide?
5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide has a molecular weight of 278.38 g/mol, XLogP of 4.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7-oxide is sourced from PubChem (CID 59403811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).