About 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum
2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum (PubChem CID 59403957) has the molecular formula C27H17N2Pt-
and a molecular weight of 564.53 g/mol. Its IUPAC name is 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum.
Molecular Properties
| Compound Name | 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum |
| PubChem CID | 59403957 |
| Molecular Formula | C27H17N2Pt- |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum |
| SMILES | [Pt].[c-]1cc2ccccc2cc1-c1nc2cc3ccccc3cc2n1-c1ccccc1 |
| InChI | InChI=1S/C27H17N2.Pt/c1-2-12-24(13-3-1)29-26-18-22-11-7-6-10-21(22)17-25(26)28-27(29)23-15-14-19-8-4-5-9-20(19)16-23;/h1-14,16-18H;/q-1; |
| InChIKey | COGOXDVENGVSHH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum?
The IUPAC name of 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum (CID 59403957) is 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum.
What is the SMILES notation for 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum?
The canonical SMILES for 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum is [Pt].[c-]1cc2ccccc2cc1-c1nc2cc3ccccc3cc2n1-c1ccccc1.
What is the InChIKey of 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum?
The InChIKey is COGOXDVENGVSHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H17N2.Pt/c1-2-12-24(13-3-1)29-26-18-22-11-7-6-10-21(22)17-25(26)28-27(29)23-15-14-19-8-4-5-9-20(19)16-23;/h1-14,16-18H;/q-1;.
What are the key properties of 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum?
2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum has a molecular weight of 564.53 g/mol, XLogP of 6.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3H-naphthalen-3-id-2-yl)-3-phenylbenzo[f]benzimidazole;platinum is sourced from PubChem (CID 59403957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).