C29H43N6O+3 — CID 59404329
11-(5,11-dimethyl-2,14-diaza-5,8,11-triazoniatetracyclo[6.6.0.02,6.010,14]tetradeca-3,5,10,12-tetraen-8-yl)-N-(4-methylphenyl)undecanamide (PubChem CID 59404329) has the molecular formula C29H43N6O+3 and a molecular weight of 491.70 g/mol. Its IUPAC name is 11-(5,11-dimethyl-2,14-diaza-5,8,11-triazoniatetracyclo[6.6.0.02,6.010,14]tetradeca-3,5,10,12-tetraen-8-yl)-N-(4-methylphenyl)undecanamide.
| Compound Name | 11-(5,11-dimethyl-2,14-diaza-5,8,11-triazoniatetracyclo[6.6.0.02,6.010,14]tetradeca-3,5,10,12-tetraen-8-yl)-N-(4-methylphenyl)undecanamide |
|---|---|
| PubChem CID | 59404329 |
| Molecular Formula | C29H43N6O+3 |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | 11-(5,11-dimethyl-2,14-diaza-5,8,11-triazoniatetracyclo[6.6.0.02,6.010,14]tetradeca-3,5,10,12-tetraen-8-yl)-N-(4-methylphenyl)undecanamide |
| SMILES | Cc1ccc(NC(=O)CCCCCCCCCC[N+]23Cc4n(cc[n+]4C)C2n2cc[n+](C)c2C3)cc1 |
| InChI | InChI=1S/C29H42N6O/c1-24-13-15-25(16-14-24)30-26(36)12-10-8-6-4-5-7-9-11-21-35-22-27-31(2)17-19-33(27)29(35)34-20-18-32(3)28(34)23-35/h13-20,29H,4-12,21-23H2,1-3H3/q+2/p+1 |
| InChIKey | NMPAFDAUWXQTBP-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 46.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|