C30H43N8O4S2+3 — CID 59404350
1-(4-aminoperoxysulfanylphenyl)-3-[8-[2,11-bis(2-oxopropyl)-5,14-diaza-2,8,11-triazoniatetracyclo[6.6.0.02,6.010,14]tetradeca-3,5,10,12-tetraen-8-yl]octyl]thiourea (PubChem CID 59404350) has the molecular formula C30H43N8O4S2+3 and a molecular weight of 643.86 g/mol. Its IUPAC name is 1-(4-aminoperoxysulfanylphenyl)-3-[8-[2,11-bis(2-oxopropyl)-5,14-diaza-2,8,11-triazoniatetracyclo[6.6.0.02,6.010,14]tetradeca-3,5,10,12-tetraen-8-yl]octyl]thiourea.
| Compound Name | 1-(4-aminoperoxysulfanylphenyl)-3-[8-[2,11-bis(2-oxopropyl)-5,14-diaza-2,8,11-triazoniatetracyclo[6.6.0.02,6.010,14]tetradeca-3,5,10,12-tetraen-8-yl]octyl]thiourea |
|---|---|
| PubChem CID | 59404350 |
| Molecular Formula | C30H43N8O4S2+3 |
| Molecular Weight | 643.86 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | 1-(4-aminoperoxysulfanylphenyl)-3-[8-[2,11-bis(2-oxopropyl)-5,14-diaza-2,8,11-triazoniatetracyclo[6.6.0.02,6.010,14]tetradeca-3,5,10,12-tetraen-8-yl]octyl]thiourea |
| SMILES | CC(=O)C[n+]1ccn2c1C[N+]1(CCCCCCCCNC(=S)Nc3ccc(SOON)cc3)CC3=NC=C[N+]3(CC(C)=O)C21 |
| InChI | InChI=1S/C30H42N8O4S2/c1-23(39)19-35-15-16-36-28(35)22-37(21-27-32-14-18-38(27,30(36)37)20-24(2)40)17-8-6-4-3-5-7-13-33-29(43)34-25-9-11-26(12-10-25)44-42-41-31/h9-12,14-16,18,30H,3-8,13,17,19-22,31H2,1-2H3,(H-,33,34,43)/q+2/p+1 |
| InChIKey | VDQIIQDDSSTBCT-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|