C28H31N3O2 — CID 59404392
tert-butyl (3R,4R)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-1-carboxylate (PubChem CID 59404392) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59404392 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | tert-butyl (3R,4R)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2c[nH]c3ccccc23)[C@H](c2cn3c4c(cccc24)CCC3)C1 |
| InChI | InChI=1S/C28H31N3O2/c1-28(2,3)33-27(32)31-16-23(21-14-29-25-12-5-4-10-19(21)25)24(17-31)22-15-30-13-7-9-18-8-6-11-20(22)26(18)30/h4-6,8,10-12,14-15,23-24,29H,7,9,13,16-17H2,1-3H3/t23-,24-/m0/s1 |
| InChIKey | WDXWMLQZMXBSAP-ZEQRLZLVSA-N |
| XLogP | 6.19 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |