C35H39ClN4O4 — CID 59404789
methyl N-[(4S)-4-(3-chloro-2-quinolin-3-ylphenyl)-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamate (PubChem CID 59404789) has the molecular formula C35H39ClN4O4 and a molecular weight of 615.17 g/mol. Its IUPAC name is methyl N-[(4S)-4-(3-chloro-2-quinolin-3-ylphenyl)-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamate.
| Compound Name | methyl N-[(4S)-4-(3-chloro-2-quinolin-3-ylphenyl)-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 59404789 |
| Molecular Formula | C35H39ClN4O4 |
| Molecular Weight | 615.17 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | methyl N-[(4S)-4-(3-chloro-2-quinolin-3-ylphenyl)-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamate |
| SMILES | CNCc1ccc(C(=O)N2CCC[C@@H]([C@@](O)(CCCNC(=O)OC)c3cccc(Cl)c3-c3cnc4ccccc4c3)C2)cc1 |
| InChI | InChI=1S/C35H39ClN4O4/c1-37-21-24-13-15-25(16-14-24)33(41)40-19-6-9-28(23-40)35(43,17-7-18-38-34(42)44-2)29-10-5-11-30(36)32(29)27-20-26-8-3-4-12-31(26)39-22-27/h3-5,8,10-16,20,22,28,37,43H,6-7,9,17-19,21,23H2,1-2H3,(H,38,42)/t28-,35+/m1/s1 |
| InChIKey | OTWSFPSIGZJXRH-CVYDZTKKSA-N |
| XLogP | 6.15 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.17 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|