C28H31ClF2N6O4 — CID 59404867
(2S,4S)-4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-[2-(dimethylamino)ethyl]-1-prop-2-enoylpiperidine-2-carboxamide (PubChem CID 59404867) has the molecular formula C28H31ClF2N6O4 and a molecular weight of 589.04 g/mol. Its IUPAC name is (2S,4S)-4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-[2-(dimethylamino)ethyl]-1-prop-2-enoylpiperidine-2-carboxamide.
| Compound Name | (2S,4S)-4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-[2-(dimethylamino)ethyl]-1-prop-2-enoylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 59404867 |
| Molecular Formula | C28H31ClF2N6O4 |
| Molecular Weight | 589.04 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | (2S,4S)-4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-[2-(dimethylamino)ethyl]-1-prop-2-enoylpiperidine-2-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](Oc2cc3c(Nc4ccc(F)c(Cl)c4F)ncnc3cc2OC)C[C@H]1C(=O)NCCN(C)C |
| InChI | InChI=1S/C28H31ClF2N6O4/c1-5-24(38)37-10-8-16(12-21(37)28(39)32-9-11-36(2)3)41-23-13-17-20(14-22(23)40-4)33-15-34-27(17)35-19-7-6-18(30)25(29)26(19)31/h5-7,13-16,21H,1,8-12H2,2-4H3,(H,32,39)(H,33,34,35)/t16-,21-/m0/s1 |
| InChIKey | VWLYPACNXYWMHC-KKSFZXQISA-N |
| XLogP | 3.92 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.04 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|