C25H25F3N6S — CID 59405013
2-[[(6R)-6-(dimethylamino)-2-methyl-5,6,7,8-tetrahydroquinolin-3-yl]amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione (PubChem CID 59405013) has the molecular formula C25H25F3N6S and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[[(6R)-6-(dimethylamino)-2-methyl-5,6,7,8-tetrahydroquinolin-3-yl]amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione.
| Compound Name | 2-[[(6R)-6-(dimethylamino)-2-methyl-5,6,7,8-tetrahydroquinolin-3-yl]amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
|---|---|
| PubChem CID | 59405013 |
| Molecular Formula | C25H25F3N6S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-[[(6R)-6-(dimethylamino)-2-methyl-5,6,7,8-tetrahydroquinolin-3-yl]amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
| SMILES | Cc1nc2c(cc1Nc1ncc3c(n1)-c1ccc(C(F)(F)F)cc1NC(=S)C3)C[C@H](N(C)C)CC2 |
| InChI | InChI=1S/C25H25F3N6S/c1-13-20(9-14-8-17(34(2)3)5-7-19(14)30-13)32-24-29-12-15-10-22(35)31-21-11-16(25(26,27)28)4-6-18(21)23(15)33-24/h4,6,9,11-12,17H,5,7-8,10H2,1-3H3,(H,31,35)(H,29,32,33)/t17-/m1/s1 |
| InChIKey | YNOWWYJOIINUKL-QGZVFWFLSA-N |
| XLogP | 5.32 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|