About 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol
2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol (PubChem CID 59405308) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol |
| PubChem CID | 59405308 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol |
| SMILES | OCCNc1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C11H13N3O2/c15-7-6-12-11-13-10(14-16-11)8-9-4-2-1-3-5-9/h1-5,15H,6-8H2,(H,12,13,14) |
| InChIKey | NZKYERGCGLEVRJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol?
The IUPAC name of 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol (CID 59405308) is 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol.
What is the SMILES notation for 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol?
The canonical SMILES for 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol is OCCNc1nc(Cc2ccccc2)no1.
What is the InChIKey of 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol?
The InChIKey is NZKYERGCGLEVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c15-7-6-12-11-13-10(14-16-11)8-9-4-2-1-3-5-9/h1-5,15H,6-8H2,(H,12,13,14).
What are the key properties of 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol?
2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol has a molecular weight of 219.24 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)amino]ethanol is sourced from PubChem (CID 59405308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).