C20H29ClN6O2 — CID 59405352
8-chloro-1-[3-[1-(2-methylpropyl)pyrazol-4-yl]propyl]-3-pentyl-7H-purine-2,6-dione (PubChem CID 59405352) has the molecular formula C20H29ClN6O2 and a molecular weight of 420.95 g/mol. Its IUPAC name is 8-chloro-1-[3-[1-(2-methylpropyl)pyrazol-4-yl]propyl]-3-pentyl-7H-purine-2,6-dione.
| Compound Name | 8-chloro-1-[3-[1-(2-methylpropyl)pyrazol-4-yl]propyl]-3-pentyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59405352 |
| Molecular Formula | C20H29ClN6O2 |
| Molecular Weight | 420.95 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 8-chloro-1-[3-[1-(2-methylpropyl)pyrazol-4-yl]propyl]-3-pentyl-7H-purine-2,6-dione |
| SMILES | CCCCCn1c(=O)n(CCCc2cnn(CC(C)C)c2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C20H29ClN6O2/c1-4-5-6-9-26-17-16(23-19(21)24-17)18(28)27(20(26)29)10-7-8-15-11-22-25(13-15)12-14(2)3/h11,13-14H,4-10,12H2,1-3H3,(H,23,24) |
| InChIKey | OJVYVFIEKUSWKK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.95 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|