About 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate
3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate (PubChem CID 59405495) has the molecular formula C23H28ClN5O4
and a molecular weight of 473.96 g/mol. Its IUPAC name is 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate.
Molecular Properties
| Compound Name | 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate |
| PubChem CID | 59405495 |
| Molecular Formula | C23H28ClN5O4 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate |
| SMILES | CCCCCn1c(=O)n(CCCOC(=O)NC2(c3ccccc3)CC2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C23H28ClN5O4/c1-2-3-7-13-28-18-17(25-20(24)26-18)19(30)29(22(28)32)14-8-15-33-21(31)27-23(11-12-23)16-9-5-4-6-10-16/h4-6,9-10H,2-3,7-8,11-15H2,1H3,(H,25,26)(H,27,31) |
| InChIKey | GDNLJOVNFANMHX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate?
The IUPAC name of 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate (CID 59405495) is 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate.
What is the SMILES notation for 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate?
The canonical SMILES for 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate is CCCCCn1c(=O)n(CCCOC(=O)NC2(c3ccccc3)CC2)c(=O)c2[nH]c(Cl)nc21.
What is the InChIKey of 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate?
The InChIKey is GDNLJOVNFANMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClN5O4/c1-2-3-7-13-28-18-17(25-20(24)26-18)19(30)29(22(28)32)14-8-15-33-21(31)27-23(11-12-23)16-9-5-4-6-10-16/h4-6,9-10H,2-3,7-8,11-15H2,1H3,(H,25,26)(H,27,31).
What are the key properties of 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate?
3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate has a molecular weight of 473.96 g/mol, XLogP of 3.54, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-(1-phenylcyclopropyl)carbamate is sourced from PubChem (CID 59405495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).