C19H23Cl2N5O5S — CID 59406906
ethyl 2-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-[(E)-hydroxyiminomethyl]-1,3-thiazole-5-carboxylate (PubChem CID 59406906) has the molecular formula C19H23Cl2N5O5S and a molecular weight of 504.40 g/mol. Its IUPAC name is ethyl 2-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-[(E)-hydroxyiminomethyl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-[(E)-hydroxyiminomethyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59406906 |
| Molecular Formula | C19H23Cl2N5O5S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | ethyl 2-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-[(E)-hydroxyiminomethyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2CCC(NC(=O)c3[nH]c(C)c(Cl)c3Cl)C(OC)C2)nc1/C=N/O |
| InChI | InChI=1S/C19H23Cl2N5O5S/c1-4-31-18(28)16-11(7-22-29)25-19(32-16)26-6-5-10(12(8-26)30-3)24-17(27)15-14(21)13(20)9(2)23-15/h7,10,12,23,29H,4-6,8H2,1-3H3,(H,24,27)/b22-7+ |
| InChIKey | RQXIYZPPAKEIBT-QPJQQBGISA-N |
| XLogP | 3.09 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|