C25H32F3NO3 — CID 59407541
2-amino-2-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 59407541) has the molecular formula C25H32F3NO3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 59407541 |
| Molecular Formula | C25H32F3NO3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-amino-2-[2-[4-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CCc1ccc(OCCCC2CCCc3ccccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H32F3NO3/c26-25(27,28)22-15-18(12-13-24(29,16-30)17-31)10-11-23(22)32-14-4-8-20-7-3-6-19-5-1-2-9-21(19)20/h1-2,5,9-11,15,20,30-31H,3-4,6-8,12-14,16-17,29H2 |
| InChIKey | NVLGBYFHXZBBGP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|