About N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide
N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 59408210) has the molecular formula C13H17F2N3O3
and a molecular weight of 301.29 g/mol. Its IUPAC name is N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| PubChem CID | 59408210 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CC[C@H]1OC(n2ccc(NC(C)=O)nc2=O)C(F)(F)C1C |
| InChI | InChI=1S/C13H17F2N3O3/c1-4-9-7(2)13(14,15)11(21-9)18-6-5-10(16-8(3)19)17-12(18)20/h5-7,9,11H,4H2,1-3H3,(H,16,17,19,20)/t7?,9-,11?/m1/s1 |
| InChIKey | WHVMVXXPYNNNHE-PUDKOPFASA-N |
| XLogP | 1.78 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide?
The IUPAC name of N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (CID 59408210) is N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide?
The canonical SMILES for N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide is CC[C@H]1OC(n2ccc(NC(C)=O)nc2=O)C(F)(F)C1C.
What is the InChIKey of N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide?
The InChIKey is WHVMVXXPYNNNHE-PUDKOPFASA-N. The full InChI is InChI=1S/C13H17F2N3O3/c1-4-9-7(2)13(14,15)11(21-9)18-6-5-10(16-8(3)19)17-12(18)20/h5-7,9,11H,4H2,1-3H3,(H,16,17,19,20)/t7?,9-,11?/m1/s1.
What are the key properties of N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide?
N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide has a molecular weight of 301.29 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(5R)-5-ethyl-3,3-difluoro-4-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide is sourced from PubChem (CID 59408210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).