C12H16O2 — CID 59408282
(E,2S,3S)-2-methyl-5-phenylpent-4-ene-1,3-diol (PubChem CID 59408282) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (E,2S,3S)-2-methyl-5-phenylpent-4-ene-1,3-diol.
| Compound Name | (E,2S,3S)-2-methyl-5-phenylpent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 59408282 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (E,2S,3S)-2-methyl-5-phenylpent-4-ene-1,3-diol |
| SMILES | C[C@@H](CO)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-10(9-13)12(14)8-7-11-5-3-2-4-6-11/h2-8,10,12-14H,9H2,1H3/b8-7+/t10-,12-/m0/s1 |
| InChIKey | JNFCGBNYOJIKHB-HUAGXHDJSA-N |
| XLogP | 1.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |