C11H16N2O2 — CID 59408340
3,3,5,5-tetramethyl-1-prop-2-ynylpiperazine-2,6-dione (PubChem CID 59408340) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-prop-2-ynylpiperazine-2,6-dione.
| Compound Name | 3,3,5,5-tetramethyl-1-prop-2-ynylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 59408340 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-prop-2-ynylpiperazine-2,6-dione |
| SMILES | C#CCN1C(=O)C(C)(C)NC(C)(C)C1=O |
| InChI | InChI=1S/C11H16N2O2/c1-6-7-13-8(14)10(2,3)12-11(4,5)9(13)15/h1,12H,7H2,2-5H3 |
| InChIKey | CJNQECXDLREODH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|