C40H16F12N8 — CID 59408404
[5-isocyanoimino-2,3,7,8-tetrakis[4-(trifluoromethyl)phenyl]pyrazino[2,3-g]quinoxalin-10-ylidene]cyanamide (PubChem CID 59408404) has the molecular formula C40H16F12N8 and a molecular weight of 836.60 g/mol. Its IUPAC name is [5-isocyanoimino-2,3,7,8-tetrakis[4-(trifluoromethyl)phenyl]pyrazino[2,3-g]quinoxalin-10-ylidene]cyanamide.
| Compound Name | [5-isocyanoimino-2,3,7,8-tetrakis[4-(trifluoromethyl)phenyl]pyrazino[2,3-g]quinoxalin-10-ylidene]cyanamide |
|---|---|
| PubChem CID | 59408404 |
| Molecular Formula | C40H16F12N8 |
| Molecular Weight | 836.60 g/mol |
| Exact Mass | 836.13 |
| IUPAC Name | [5-isocyanoimino-2,3,7,8-tetrakis[4-(trifluoromethyl)phenyl]pyrazino[2,3-g]quinoxalin-10-ylidene]cyanamide |
| SMILES | [C-]#[N+]N=C1c2nc(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(C(F)(F)F)cc3)nc2C(=NC#N)c2nc(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(C(F)(F)F)cc3)nc21 |
| InChI | InChI=1S/C40H16F12N8/c1-54-60-36-34-32(56-27(19-2-10-23(11-3-19)37(41,42)43)29(58-34)21-6-14-25(15-7-21)39(47,48)49)31(55-18-53)33-35(36)59-30(22-8-16-26(17-9-22)40(50,51)52)28(57-33)20-4-12-24(13-5-20)38(44,45)46/h2-17H/b55-31-,60-36+ |
| InChIKey | XPOLPFMBMGISRL-KTKFPBPSSA-N |
| XLogP | 11.31 |
| TPSA | 104.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.60 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|