C44H12F24N8 — CID 59408424
[2,3,7,8-tetrakis[3,5-bis(trifluoromethyl)phenyl]-5-isocyanoiminopyrazino[2,3-g]quinoxalin-10-ylidene]cyanamide (PubChem CID 59408424) has the molecular formula C44H12F24N8 and a molecular weight of 1108.59 g/mol. Its IUPAC name is [2,3,7,8-tetrakis[3,5-bis(trifluoromethyl)phenyl]-5-isocyanoiminopyrazino[2,3-g]quinoxalin-10-ylidene]cyanamide.
| Compound Name | [2,3,7,8-tetrakis[3,5-bis(trifluoromethyl)phenyl]-5-isocyanoiminopyrazino[2,3-g]quinoxalin-10-ylidene]cyanamide |
|---|---|
| PubChem CID | 59408424 |
| Molecular Formula | C44H12F24N8 |
| Molecular Weight | 1108.59 g/mol |
| Exact Mass | 1108.08 |
| IUPAC Name | [2,3,7,8-tetrakis[3,5-bis(trifluoromethyl)phenyl]-5-isocyanoiminopyrazino[2,3-g]quinoxalin-10-ylidene]cyanamide |
| SMILES | [C-]#[N+]N=C1c2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc2C(=NC#N)c2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc21 |
| InChI | InChI=1S/C44H12F24N8/c1-70-76-36-34-32(72-27(15-2-19(37(45,46)47)10-20(3-15)38(48,49)50)29(74-34)17-6-23(41(57,58)59)12-24(7-17)42(60,61)62)31(71-14-69)33-35(36)75-30(18-8-25(43(63,64)65)13-26(9-18)44(66,67)68)28(73-33)16-4-21(39(51,52)53)11-22(5-16)40(54,55)56/h2-13H/b71-31-,76-36+ |
| InChIKey | XDCOUAUZFOVVHB-SWKWDGEXSA-N |
| XLogP | 15.39 |
| TPSA | 104.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.59 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|