About [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate
[4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate (PubChem CID 59408535) has the molecular formula C27H42O8
and a molecular weight of 494.63 g/mol. Its IUPAC name is [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate |
| PubChem CID | 59408535 |
| Molecular Formula | C27H42O8 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate |
| SMILES | O=C(OC1COC(CO)C(OC(=O)C2CCCCC2)C1OC(=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C27H42O8/c28-16-21-23(34-26(30)19-12-6-2-7-13-19)24(35-27(31)20-14-8-3-9-15-20)22(17-32-21)33-25(29)18-10-4-1-5-11-18/h18-24,28H,1-17H2 |
| InChIKey | QGFCGYXMJVFGBA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate?
The IUPAC name of [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate (CID 59408535) is [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate.
What is the SMILES notation for [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate?
The canonical SMILES for [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate is O=C(OC1COC(CO)C(OC(=O)C2CCCCC2)C1OC(=O)C1CCCCC1)C1CCCCC1.
What is the InChIKey of [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate?
The InChIKey is QGFCGYXMJVFGBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H42O8/c28-16-21-23(34-26(30)19-12-6-2-7-13-19)24(35-27(31)20-14-8-3-9-15-20)22(17-32-21)33-25(29)18-10-4-1-5-11-18/h18-24,28H,1-17H2.
What are the key properties of [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate?
[4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate has a molecular weight of 494.63 g/mol, XLogP of 3.85, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-bis(cyclohexanecarbonyloxy)-6-(hydroxymethyl)oxan-3-yl] cyclohexanecarboxylate is sourced from PubChem (CID 59408535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).