C27H38N8O6ReS2 — CID 59408675
2-[2-[[8-[(4-aminoperoxysulfanylphenyl)carbamothioylamino]octyl-[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]methyl]imidazol-1-yl]acetic acid;rhenium (PubChem CID 59408675) has the molecular formula C27H38N8O6ReS2 and a molecular weight of 820.99 g/mol. Its IUPAC name is 2-[2-[[8-[(4-aminoperoxysulfanylphenyl)carbamothioylamino]octyl-[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]methyl]imidazol-1-yl]acetic acid;rhenium.
| Compound Name | 2-[2-[[8-[(4-aminoperoxysulfanylphenyl)carbamothioylamino]octyl-[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]methyl]imidazol-1-yl]acetic acid;rhenium |
|---|---|
| PubChem CID | 59408675 |
| Molecular Formula | C27H38N8O6ReS2 |
| Molecular Weight | 820.99 g/mol |
| Exact Mass | 821.19 |
| IUPAC Name | 2-[2-[[8-[(4-aminoperoxysulfanylphenyl)carbamothioylamino]octyl-[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]methyl]imidazol-1-yl]acetic acid;rhenium |
| SMILES | NOOSc1ccc(NC(=S)NCCCCCCCCN(Cc2nccn2CC(=O)O)Cc2nccn2CC(=O)O)cc1.[Re] |
| InChI | InChI=1S/C27H38N8O6S2.Re/c28-40-41-43-22-9-7-21(8-10-22)32-27(42)31-11-5-3-1-2-4-6-14-33(17-23-29-12-15-34(23)19-25(36)37)18-24-30-13-16-35(24)20-26(38)39;/h7-10,12-13,15-16H,1-6,11,14,17-20,28H2,(H,36,37)(H,38,39)(H2,31,32,42); |
| InChIKey | OLHTYPTXMNUVFH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.99 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|