About 5-benzyl-1H-imidazole
5-benzyl-1H-imidazole (PubChem CID 594090) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 5-benzyl-1H-imidazole.
Molecular Properties
| Compound Name | 5-benzyl-1H-imidazole |
| PubChem CID | 594090 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 5-benzyl-1H-imidazole |
| SMILES | c1ccc(Cc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C10H10N2/c1-2-4-9(5-3-1)6-10-7-11-8-12-10/h1-5,7-8H,6H2,(H,11,12) |
| InChIKey | HREUGOAZLRNTEM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-benzyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-1H-imidazole?
The IUPAC name of 5-benzyl-1H-imidazole (CID 594090) is 5-benzyl-1H-imidazole.
What is the SMILES notation for 5-benzyl-1H-imidazole?
The canonical SMILES for 5-benzyl-1H-imidazole is c1ccc(Cc2cnc[nH]2)cc1.
What is the InChIKey of 5-benzyl-1H-imidazole?
The InChIKey is HREUGOAZLRNTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-4-9(5-3-1)6-10-7-11-8-12-10/h1-5,7-8H,6H2,(H,11,12).
What are the key properties of 5-benzyl-1H-imidazole?
5-benzyl-1H-imidazole has a molecular weight of 158.20 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1H-imidazole is sourced from PubChem (CID 594090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).