C17H15F4O4S- — CID 59409221
4-[(4-butan-2-ylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 59409221) has the molecular formula C17H15F4O4S- and a molecular weight of 391.36 g/mol. Its IUPAC name is 4-[(4-butan-2-ylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[(4-butan-2-ylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 59409221 |
| Molecular Formula | C17H15F4O4S- |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 4-[(4-butan-2-ylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CCC(C)c1ccc(COc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1 |
| InChI | InChI=1S/C17H16F4O4S/c1-3-9(2)11-6-4-10(5-7-11)8-25-16-12(18)14(20)17(26(22,23)24)15(21)13(16)19/h4-7,9H,3,8H2,1-2H3,(H,22,23,24)/p-1 |
| InChIKey | XKHLVAKGRGEWFC-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|