C17H16F4O4S — CID 59409222
4-[(4-butan-2-ylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 59409222) has the molecular formula C17H16F4O4S and a molecular weight of 392.37 g/mol. Its IUPAC name is 4-[(4-butan-2-ylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[(4-butan-2-ylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 59409222 |
| Molecular Formula | C17H16F4O4S |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 4-[(4-butan-2-ylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCC(C)c1ccc(COc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H16F4O4S/c1-3-9(2)11-6-4-10(5-7-11)8-25-16-12(18)14(20)17(26(22,23)24)15(21)13(16)19/h4-7,9H,3,8H2,1-2H3,(H,22,23,24) |
| InChIKey | XKHLVAKGRGEWFC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|