C16H26O2 — CID 59409243
1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylen-1-yl 2-methylpropanoate (PubChem CID 59409243) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylen-1-yl 2-methylpropanoate.
| Compound Name | 1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylen-1-yl 2-methylpropanoate |
|---|---|
| PubChem CID | 59409243 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylen-1-yl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1CC2CCCC3CCCC1C32 |
| InChI | InChI=1S/C16H26O2/c1-10(2)16(17)18-14-9-12-7-3-5-11-6-4-8-13(14)15(11)12/h10-15H,3-9H2,1-2H3 |
| InChIKey | AVFKZJQKTLINAF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |