C29H50N10O8 — CID 59409284
6-[2-[3-[2-[4,6-bis(ethoxymethylamino)-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2-N,4-N-bis(ethoxymethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 59409284) has the molecular formula C29H50N10O8 and a molecular weight of 666.78 g/mol. Its IUPAC name is 6-[2-[3-[2-[4,6-bis(ethoxymethylamino)-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2-N,4-N-bis(ethoxymethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-[3-[2-[4,6-bis(ethoxymethylamino)-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2-N,4-N-bis(ethoxymethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 59409284 |
| Molecular Formula | C29H50N10O8 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.38 |
| IUPAC Name | 6-[2-[3-[2-[4,6-bis(ethoxymethylamino)-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2-N,4-N-bis(ethoxymethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOCNc1nc(CCC2OCC3(CO2)COC(CCc2nc(NCOCC)nc(NCOCC)n2)OC3)nc(NCOCC)n1 |
| InChI | InChI=1S/C29H50N10O8/c1-5-40-17-30-25-34-21(35-26(38-25)31-18-41-6-2)9-11-23-44-13-29(14-45-23)15-46-24(47-16-29)12-10-22-36-27(32-19-42-7-3)39-28(37-22)33-20-43-8-4/h23-24H,5-20H2,1-4H3,(H2,30,31,34,35,38)(H2,32,33,36,37,39) |
| InChIKey | SCRBSAGQKQRZJZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 199.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|