C21H34N10O8 — CID 59409292
[[4-[2-[3-[2-[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-6-(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol (PubChem CID 59409292) has the molecular formula C21H34N10O8 and a molecular weight of 554.57 g/mol. Its IUPAC name is [[4-[2-[3-[2-[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-6-(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol.
| Compound Name | [[4-[2-[3-[2-[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-6-(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol |
|---|---|
| PubChem CID | 59409292 |
| Molecular Formula | C21H34N10O8 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | [[4-[2-[3-[2-[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-6-(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol |
| SMILES | OCNc1nc(CCC2OCC3(CO2)COC(CCc2nc(NCO)nc(NCO)n2)OC3)nc(NCO)n1 |
| InChI | InChI=1S/C21H34N10O8/c32-9-22-17-26-13(27-18(30-17)23-10-33)1-3-15-36-5-21(6-37-15)7-38-16(39-8-21)4-2-14-28-19(24-11-34)31-20(29-14)25-12-35/h15-16,32-35H,1-12H2,(H2,22,23,26,27,30)(H2,24,25,28,29,31) |
| InChIKey | YFZFCKNDHXOAGB-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 243.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|