C15H20F2O5S — CID 59409345
1,1-difluoro-2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethoxy)ethanesulfonic acid (PubChem CID 59409345) has the molecular formula C15H20F2O5S and a molecular weight of 350.38 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethoxy)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 59409345 |
| Molecular Formula | C15H20F2O5S |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethoxy)ethanesulfonic acid |
| SMILES | O=C(OCC1CC2CC1C1C3CCC(C3)C21)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C15H20F2O5S/c16-15(17,23(19,20)21)14(18)22-6-10-4-9-5-11(10)13-8-2-1-7(3-8)12(9)13/h7-13H,1-6H2,(H,19,20,21) |
| InChIKey | BFLDWHNLEUVUQB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|