C13H4F23O6S3- — CID 59409389
1,1,1,2,2,3,3,4,4-nonafluoro-4-[1,1,2,2,4,4,4-heptafluorobutylsulfonyl(2,2,3,3,4,4,4-heptafluorobutylsulfonyl)methyl]sulfonylbutane (PubChem CID 59409389) has the molecular formula C13H4F23O6S3- and a molecular weight of 789.32 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-4-[1,1,2,2,4,4,4-heptafluorobutylsulfonyl(2,2,3,3,4,4,4-heptafluorobutylsulfonyl)methyl]sulfonylbutane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-[1,1,2,2,4,4,4-heptafluorobutylsulfonyl(2,2,3,3,4,4,4-heptafluorobutylsulfonyl)methyl]sulfonylbutane |
|---|---|
| PubChem CID | 59409389 |
| Molecular Formula | C13H4F23O6S3- |
| Molecular Weight | 789.32 g/mol |
| Exact Mass | 788.88 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-[1,1,2,2,4,4,4-heptafluorobutylsulfonyl(2,2,3,3,4,4,4-heptafluorobutylsulfonyl)methyl]sulfonylbutane |
| SMILES | O=S(=O)(CC(F)(F)C(F)(F)C(F)(F)F)[C-](S(=O)(=O)C(F)(F)C(F)(F)CC(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H4F23O6S3/c14-4(15,1-6(18,19)20)12(33,34)44(39,40)3(43(37,38)2-5(16,17)7(21,22)10(27,28)29)45(41,42)13(35,36)9(25,26)8(23,24)11(30,31)32/h1-2H2/q-1 |
| InChIKey | WKRLDOXADRWWMQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.32 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|