C15H20F4O3S — CID 59409403
1,1,1,2-tetrafluoro-3-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propane-2-sulfonic acid (PubChem CID 59409403) has the molecular formula C15H20F4O3S and a molecular weight of 356.38 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propane-2-sulfonic acid.
| Compound Name | 1,1,1,2-tetrafluoro-3-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propane-2-sulfonic acid |
|---|---|
| PubChem CID | 59409403 |
| Molecular Formula | C15H20F4O3S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(CC1CC2CC1C1C3CCC(C3)C21)C(F)(F)F |
| InChI | InChI=1S/C15H20F4O3S/c16-14(15(17,18)19,23(20,21)22)6-10-4-9-5-11(10)13-8-2-1-7(3-8)12(9)13/h7-13H,1-6H2,(H,20,21,22) |
| InChIKey | ITZXLTMZYNMRQJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|